C31H29FN2O7 — CID 72708658
(5S,5aS,8aR,9R)-5-[(5-fluoro-1H-indol-3-yl)methylamino]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 72708658) has the molecular formula C31H29FN2O7 and a molecular weight of 560.58 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-[(5-fluoro-1H-indol-3-yl)methylamino]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-[(5-fluoro-1H-indol-3-yl)methylamino]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 72708658 |
| Molecular Formula | C31H29FN2O7 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-[(5-fluoro-1H-indol-3-yl)methylamino]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](NCc3c[nH]c5ccc(F)cc35)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C31H29FN2O7/c1-36-25-6-15(7-26(37-2)30(25)38-3)27-19-9-23-24(41-14-40-23)10-20(19)29(21-13-39-31(35)28(21)27)34-12-16-11-33-22-5-4-17(32)8-18(16)22/h4-11,21,27-29,33-34H,12-14H2,1-3H3/t21-,27+,28-,29+/m0/s1 |
| InChIKey | ZAHLNGBZWCUTIT-MHTDFPPDSA-N |
| XLogP | 4.83 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |