C20H23NO2 — CID 72709163
1-(adamantane-1-carbonyl)-2,3-dihydroquinolin-4-one (PubChem CID 72709163) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(adamantane-1-carbonyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 72709163 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| InChI | InChI=1S/C20H23NO2/c22-18-5-6-21(17-4-2-1-3-16(17)18)19(23)20-10-13-7-14(11-20)9-15(8-13)12-20/h1-4,13-15H,5-12H2 |
| InChIKey | VXTHIPICDQCHJC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |