C27H20ClNO4 — CID 72710910
[(2R,3R)-4-oxo-2-phenyl-1-[(E)-3-phenylprop-2-enoyl]-2,3-dihydropyridin-3-yl] 4-chlorobenzoate (PubChem CID 72710910) has the molecular formula C27H20ClNO4 and a molecular weight of 457.91 g/mol. Its IUPAC name is [(2R,3R)-4-oxo-2-phenyl-1-[(E)-3-phenylprop-2-enoyl]-2,3-dihydropyridin-3-yl] 4-chlorobenzoate.
| Compound Name | [(2R,3R)-4-oxo-2-phenyl-1-[(E)-3-phenylprop-2-enoyl]-2,3-dihydropyridin-3-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 72710910 |
| Molecular Formula | C27H20ClNO4 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | [(2R,3R)-4-oxo-2-phenyl-1-[(E)-3-phenylprop-2-enoyl]-2,3-dihydropyridin-3-yl] 4-chlorobenzoate |
| SMILES | O=C(O[C@H]1C(=O)C=CN(C(=O)/C=C/c2ccccc2)[C@@H]1c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20ClNO4/c28-22-14-12-21(13-15-22)27(32)33-26-23(30)17-18-29(25(26)20-9-5-2-6-10-20)24(31)16-11-19-7-3-1-4-8-19/h1-18,25-26H/b16-11+/t25-,26+/m1/s1 |
| InChIKey | FCLKSQIUOMTAJK-XWXAVHJMSA-N |
| XLogP | 5.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|