C26H25N3O2Se — CID 72711221
2-[[3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinolin-2-yl]selanyl]-N-(4-methylphenyl)acetamide (PubChem CID 72711221) has the molecular formula C26H25N3O2Se and a molecular weight of 490.47 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinolin-2-yl]selanyl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[[3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinolin-2-yl]selanyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 72711221 |
| Molecular Formula | C26H25N3O2Se |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 2-[[3-cyano-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinolin-2-yl]selanyl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[Se]C2=C(C#N)C(c3ccc(C)cc3)C3=C(CCCC3=O)N2)cc1 |
| InChI | InChI=1S/C26H25N3O2Se/c1-16-6-10-18(11-7-16)24-20(14-27)26(29-21-4-3-5-22(30)25(21)24)32-15-23(31)28-19-12-8-17(2)9-13-19/h6-13,24,29H,3-5,15H2,1-2H3,(H,28,31) |
| InChIKey | CGDBLOASPGVZPI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|