C10H13NO2 — CID 72711922
5-hydroxy-1,5-bis(prop-2-enyl)pyrrol-2-one (PubChem CID 72711922) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 5-hydroxy-1,5-bis(prop-2-enyl)pyrrol-2-one.
| Compound Name | 5-hydroxy-1,5-bis(prop-2-enyl)pyrrol-2-one |
|---|---|
| PubChem CID | 72711922 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 5-hydroxy-1,5-bis(prop-2-enyl)pyrrol-2-one |
| SMILES | C=CCN1C(=O)C=CC1(O)CC=C |
| InChI | InChI=1S/C10H13NO2/c1-3-6-10(13)7-5-9(12)11(10)8-4-2/h3-5,7,13H,1-2,6,8H2 |
| InChIKey | BMJAHVHSPBEKKU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|