C9H11NO2 — CID 72711924
9a-hydroxy-6,9-dihydro-5H-pyrrolo[1,2-a]azepin-3-one (PubChem CID 72711924) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 9a-hydroxy-6,9-dihydro-5H-pyrrolo[1,2-a]azepin-3-one.
| Compound Name | 9a-hydroxy-6,9-dihydro-5H-pyrrolo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 72711924 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 9a-hydroxy-6,9-dihydro-5H-pyrrolo[1,2-a]azepin-3-one |
| SMILES | O=C1C=CC2(O)CC=CCCN12 |
| InChI | InChI=1S/C9H11NO2/c11-8-4-6-9(12)5-2-1-3-7-10(8)9/h1-2,4,6,12H,3,5,7H2 |
| InChIKey | SAQRWDYILZSDGX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|