C21H21BrN4O — CID 72712448
(3-benzylpiperidin-1-yl)-[4-(4-bromophenyl)triazol-1-yl]methanone (PubChem CID 72712448) has the molecular formula C21H21BrN4O and a molecular weight of 425.33 g/mol. Its IUPAC name is (3-benzylpiperidin-1-yl)-[4-(4-bromophenyl)triazol-1-yl]methanone.
| Compound Name | (3-benzylpiperidin-1-yl)-[4-(4-bromophenyl)triazol-1-yl]methanone |
|---|---|
| PubChem CID | 72712448 |
| Molecular Formula | C21H21BrN4O |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (3-benzylpiperidin-1-yl)-[4-(4-bromophenyl)triazol-1-yl]methanone |
| SMILES | O=C(N1CCCC(Cc2ccccc2)C1)n1cc(-c2ccc(Br)cc2)nn1 |
| InChI | InChI=1S/C21H21BrN4O/c22-19-10-8-18(9-11-19)20-15-26(24-23-20)21(27)25-12-4-7-17(14-25)13-16-5-2-1-3-6-16/h1-3,5-6,8-11,15,17H,4,7,12-14H2 |
| InChIKey | COJFTIMEDFIAAE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |