C23H25N5O3 — CID 159931330
methyl 3-benzyl-4-[4-(4-methylphenyl)triazole-1-carbonyl]piperazine-1-carboxylate (PubChem CID 159931330) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is methyl 3-benzyl-4-[4-(4-methylphenyl)triazole-1-carbonyl]piperazine-1-carboxylate.
| Compound Name | methyl 3-benzyl-4-[4-(4-methylphenyl)triazole-1-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 159931330 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | methyl 3-benzyl-4-[4-(4-methylphenyl)triazole-1-carbonyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)n2cc(-c3ccc(C)cc3)nn2)C(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H25N5O3/c1-17-8-10-19(11-9-17)21-16-28(25-24-21)22(29)27-13-12-26(23(30)31-2)15-20(27)14-18-6-4-3-5-7-18/h3-11,16,20H,12-15H2,1-2H3 |
| InChIKey | WOKIUWYEIKJLTQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |