C20H28N4O8 — CID 177187775
2-[(4-methylphenyl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7,10-tetracarboxylic acid (PubChem CID 177187775) has the molecular formula C20H28N4O8 and a molecular weight of 452.46 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7,10-tetracarboxylic acid.
| Compound Name | 2-[(4-methylphenyl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 177187775 |
| Molecular Formula | C20H28N4O8 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-1,4,7,10-tetrazacyclododecane-1,4,7,10-tetracarboxylic acid |
| SMILES | Cc1ccc(CC2CN(C(=O)O)CCN(C(=O)O)CCN(C(=O)O)CCN2C(=O)O)cc1 |
| InChI | InChI=1S/C20H28N4O8/c1-14-2-4-15(5-3-14)12-16-13-23(19(29)30)9-8-21(17(25)26)6-7-22(18(27)28)10-11-24(16)20(31)32/h2-5,16H,6-13H2,1H3,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | QCHHLLWTDNKPDS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |