C28H26N4O3 — CID 68665680
(3R)-3-benzyl-4-(3,4-diphenyl-1H-pyrazole-5-carbonyl)piperazine-1-carboxylic acid (PubChem CID 68665680) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is (3R)-3-benzyl-4-(3,4-diphenyl-1H-pyrazole-5-carbonyl)piperazine-1-carboxylic acid.
| Compound Name | (3R)-3-benzyl-4-(3,4-diphenyl-1H-pyrazole-5-carbonyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68665680 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (3R)-3-benzyl-4-(3,4-diphenyl-1H-pyrazole-5-carbonyl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(C(=O)c2[nH]nc(-c3ccccc3)c2-c2ccccc2)[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C28H26N4O3/c33-27(32-17-16-31(28(34)35)19-23(32)18-20-10-4-1-5-11-20)26-24(21-12-6-2-7-13-21)25(29-30-26)22-14-8-3-9-15-22/h1-15,23H,16-19H2,(H,29,30)(H,34,35)/t23-/m1/s1 |
| InChIKey | WGCYDRRQGHDNMF-HSZRJFAPSA-N |
| XLogP | 4.79 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |