C28H28N4O2 — CID 97301456
[(2R)-2-benzylpiperidin-1-yl]-[4-[4-(4-methoxyphenyl)phenyl]triazol-1-yl]methanone (PubChem CID 97301456) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is [(2R)-2-benzylpiperidin-1-yl]-[4-[4-(4-methoxyphenyl)phenyl]triazol-1-yl]methanone.
| Compound Name | [(2R)-2-benzylpiperidin-1-yl]-[4-[4-(4-methoxyphenyl)phenyl]triazol-1-yl]methanone |
|---|---|
| PubChem CID | 97301456 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [(2R)-2-benzylpiperidin-1-yl]-[4-[4-(4-methoxyphenyl)phenyl]triazol-1-yl]methanone |
| SMILES | COc1ccc(-c2ccc(-c3cn(C(=O)N4CCCC[C@@H]4Cc4ccccc4)nn3)cc2)cc1 |
| InChI | InChI=1S/C28H28N4O2/c1-34-26-16-14-23(15-17-26)22-10-12-24(13-11-22)27-20-32(30-29-27)28(33)31-18-6-5-9-25(31)19-21-7-3-2-4-8-21/h2-4,7-8,10-17,20,25H,5-6,9,18-19H2,1H3/t25-/m1/s1 |
| InChIKey | OUPCOAXNGFVFJZ-RUZDIDTESA-N |
| XLogP | 5.69 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |