C27H32N2O4 — CID 72715713
(Z)-but-2-enedioic acid;1-methyl-4-[2-(2-methyl-4-phenyl-3H-inden-1-yl)ethyl]piperazine (PubChem CID 72715713) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-methyl-4-[2-(2-methyl-4-phenyl-3H-inden-1-yl)ethyl]piperazine.
| Compound Name | (Z)-but-2-enedioic acid;1-methyl-4-[2-(2-methyl-4-phenyl-3H-inden-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 72715713 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-methyl-4-[2-(2-methyl-4-phenyl-3H-inden-1-yl)ethyl]piperazine |
| SMILES | CC1=C(CCN2CCN(C)CC2)c2cccc(-c3ccccc3)c2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C23H28N2.C4H4O4/c1-18-17-23-21(19-7-4-3-5-8-19)9-6-10-22(23)20(18)11-12-25-15-13-24(2)14-16-25;5-3(6)1-2-4(7)8/h3-10H,11-17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | OYZWXZYTJPUPMP-BTJKTKAUSA-N |
| XLogP | 4.03 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|