C11H9N3O — CID 72724241
(2Z)-2-[(4-cyanophenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 72724241) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is (2Z)-2-[(4-cyanophenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-[(4-cyanophenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 72724241 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | (2Z)-2-[(4-cyanophenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | N#Cc1ccc(/C=[N+]2/CCC([O-])=N2)cc1 |
| InChI | InChI=1S/C11H9N3O/c12-7-9-1-3-10(4-2-9)8-14-6-5-11(15)13-14/h1-4,8H,5-6H2/b14-8- |
| InChIKey | ALQVXLXPJDLPDN-ZSOIEALJSA-N |
| XLogP | 0.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|