C23H33NO4 — CID 72725193
5-cyclopentyloxy-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid (PubChem CID 72725193) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 5-cyclopentyloxy-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid.
| Compound Name | 5-cyclopentyloxy-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid |
|---|---|
| PubChem CID | 72725193 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 5-cyclopentyloxy-2-[(4-methylcyclohexanecarbonyl)-propan-2-ylamino]benzoic acid |
| SMILES | CC1CCC(C(=O)N(c2ccc(OC3CCCC3)cc2C(=O)O)C(C)C)CC1 |
| InChI | InChI=1S/C23H33NO4/c1-15(2)24(22(25)17-10-8-16(3)9-11-17)21-13-12-19(14-20(21)23(26)27)28-18-6-4-5-7-18/h12-18H,4-11H2,1-3H3,(H,26,27) |
| InChIKey | UWEQDVJTANYERF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |