C10H5NO5 — CID 72727429
4,5,8-trioxo-1H-quinoline-2-carboxylic acid (PubChem CID 72727429) has the molecular formula C10H5NO5 and a molecular weight of 219.15 g/mol. Its IUPAC name is 4,5,8-trioxo-1H-quinoline-2-carboxylic acid.
| Compound Name | 4,5,8-trioxo-1H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 72727429 |
| Molecular Formula | C10H5NO5 |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 4,5,8-trioxo-1H-quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2c([nH]1)C(=O)C=CC2=O |
| InChI | InChI=1S/C10H5NO5/c12-5-1-2-6(13)9-8(5)7(14)3-4(11-9)10(15)16/h1-3H,(H,11,14)(H,15,16) |
| InChIKey | FOFLUHCTQPVMLZ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|