C21H23FN2O6 — CID 7273946
[2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-(4-ethoxyphenoxy)acetate (PubChem CID 7273946) has the molecular formula C21H23FN2O6 and a molecular weight of 418.42 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-(4-ethoxyphenoxy)acetate.
| Compound Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-(4-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7273946 |
| Molecular Formula | C21H23FN2O6 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-(4-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccc(OCC(=O)OCC(=O)N(C)CC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H23FN2O6/c1-3-28-17-8-10-18(11-9-17)29-14-21(27)30-13-20(26)24(2)12-19(25)23-16-6-4-15(22)5-7-16/h4-11H,3,12-14H2,1-2H3,(H,23,25) |
| InChIKey | DOXNBAHZFSCLPP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |