C16H21FN2O5 — CID 9458350
[2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]-2-oxoethyl] 2-(4-fluorophenoxy)acetate (PubChem CID 9458350) has the molecular formula C16H21FN2O5 and a molecular weight of 340.35 g/mol. Its IUPAC name is [2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]-2-oxoethyl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 9458350 |
| Molecular Formula | C16H21FN2O5 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
| SMILES | CCCNC(=O)CN(C)C(=O)COC(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O5/c1-3-8-18-14(20)9-19(2)15(21)10-24-16(22)11-23-13-6-4-12(17)5-7-13/h4-7H,3,8-11H2,1-2H3,(H,18,20) |
| InChIKey | TUIMHIVJCKTXSF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |