C15H15N5O5S4 — CID 72739762
7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(1,3-dithiolan-2-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 72739762) has the molecular formula C15H15N5O5S4 and a molecular weight of 473.58 g/mol. Its IUPAC name is 7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(1,3-dithiolan-2-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(1,3-dithiolan-2-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 72739762 |
| Molecular Formula | C15H15N5O5S4 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(1,3-dithiolan-2-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Nc1nc(C(=NO)C(=O)NC2C(=O)N3C(C(=O)O)=C(C4SCCS4)CSC23)cs1 |
| InChI | InChI=1S/C15H15N5O5S4/c16-15-17-6(4-29-15)7(19-25)10(21)18-8-11(22)20-9(13(23)24)5(3-28-12(8)20)14-26-1-2-27-14/h4,8,12,14,25H,1-3H2,(H2,16,17)(H,18,21)(H,23,24) |
| InChIKey | DHFATOPQGIBUOZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|