C6H4N2O2 — CID 72747618
4aH-furo[2,3-d]pyrimidin-2-one (PubChem CID 72747618) has the molecular formula C6H4N2O2 and a molecular weight of 136.11 g/mol. Its IUPAC name is 4aH-furo[2,3-d]pyrimidin-2-one.
| Compound Name | 4aH-furo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 72747618 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 4aH-furo[2,3-d]pyrimidin-2-one |
| SMILES | O=C1N=CC2C=COC2=N1 |
| InChI | InChI=1S/C6H4N2O2/c9-6-7-3-4-1-2-10-5(4)8-6/h1-4H |
| InChIKey | HFDCSLQPLSVWAN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |