C6H6N2O2 — CID 90751882
4a,7a-dihydro-1H-furo[2,3-d]pyrimidin-2-one (PubChem CID 90751882) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 4a,7a-dihydro-1H-furo[2,3-d]pyrimidin-2-one.
| Compound Name | 4a,7a-dihydro-1H-furo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 90751882 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 4a,7a-dihydro-1H-furo[2,3-d]pyrimidin-2-one |
| SMILES | O=C1N=CC2C=COC2N1 |
| InChI | InChI=1S/C6H6N2O2/c9-6-7-3-4-1-2-10-5(4)8-6/h1-5H,(H,8,9) |
| InChIKey | OYEHBTRQPRYNKM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |