C10H10N2O2 — CID 6947146
(1S,2S,5R,6S)-3,7-diazatricyclo[4.2.2.22,5]dodeca-9,11-diene-4,8-dione (PubChem CID 6947146) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is (1S,2S,5R,6S)-3,7-diazatricyclo[4.2.2.22,5]dodeca-9,11-diene-4,8-dione.
| Compound Name | (1S,2S,5R,6S)-3,7-diazatricyclo[4.2.2.22,5]dodeca-9,11-diene-4,8-dione |
|---|---|
| PubChem CID | 6947146 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (1S,2S,5R,6S)-3,7-diazatricyclo[4.2.2.22,5]dodeca-9,11-diene-4,8-dione |
| SMILES | O=C1N[C@H]2C=C[C@H]1[C@@H]1C=C[C@H]2C(=O)N1 |
| InChI | InChI=1S/C10H10N2O2/c13-9-5-1-3-7(11-9)6-2-4-8(5)12-10(6)14/h1-8H,(H,11,13)(H,12,14)/t5-,6+,7-,8-/m0/s1 |
| InChIKey | WYMWYRQOKYYHPS-YWIQKCBGSA-N |
| XLogP | -0.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|