C11H11NO — CID 124916328
(1R,4R,7R,8R)-5-azatricyclo[5.3.2.04,8]dodeca-2,9,11-trien-6-one (PubChem CID 124916328) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is (1R,4R,7R,8R)-5-azatricyclo[5.3.2.04,8]dodeca-2,9,11-trien-6-one.
| Compound Name | (1R,4R,7R,8R)-5-azatricyclo[5.3.2.04,8]dodeca-2,9,11-trien-6-one |
|---|---|
| PubChem CID | 124916328 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (1R,4R,7R,8R)-5-azatricyclo[5.3.2.04,8]dodeca-2,9,11-trien-6-one |
| SMILES | O=C1N[C@@H]2C=C[C@@H]3C=C[C@@H]2[C@H]1C=C3 |
| InChI | InChI=1S/C11H11NO/c13-11-9-5-2-7-1-4-8(9)10(12-11)6-3-7/h1-10H,(H,12,13)/t7-,8-,9-,10-/m1/s1 |
| InChIKey | CNKFNLUAIMJVQJ-ZYUZMQFOSA-N |
| XLogP | 1.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|