C20H18 — CID 162425242
3-(3-tricyclo[3.3.2.02,8]deca-3,6,9-trienyl)tricyclo[3.3.2.02,8]deca-3,6,9-triene (PubChem CID 162425242) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-(3-tricyclo[3.3.2.02,8]deca-3,6,9-trienyl)tricyclo[3.3.2.02,8]deca-3,6,9-triene.
| Compound Name | 3-(3-tricyclo[3.3.2.02,8]deca-3,6,9-trienyl)tricyclo[3.3.2.02,8]deca-3,6,9-triene |
|---|---|
| PubChem CID | 162425242 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-(3-tricyclo[3.3.2.02,8]deca-3,6,9-trienyl)tricyclo[3.3.2.02,8]deca-3,6,9-triene |
| SMILES | C1=CC2C3C=CC1C=C(C1=CC4C=CC5C(C=C4)C15)C23 |
| InChI | InChI=1S/C20H18/c1-5-13-14-6-2-11(1)9-17(19(13)14)18-10-12-3-7-15-16(8-4-12)20(15)18/h1-16,19-20H |
| InChIKey | MCEHDKNCUPHTRH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|