C9H6F3NO5S — CID 163729096
8-oxido-8-(trifluoromethylsulfonyl)-8-azoniatricyclo[4.3.0.02,5]non-3-ene-7,9-dione (PubChem CID 163729096) has the molecular formula C9H6F3NO5S and a molecular weight of 297.21 g/mol. Its IUPAC name is 8-oxido-8-(trifluoromethylsulfonyl)-8-azoniatricyclo[4.3.0.02,5]non-3-ene-7,9-dione.
| Compound Name | 8-oxido-8-(trifluoromethylsulfonyl)-8-azoniatricyclo[4.3.0.02,5]non-3-ene-7,9-dione |
|---|---|
| PubChem CID | 163729096 |
| Molecular Formula | C9H6F3NO5S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 8-oxido-8-(trifluoromethylsulfonyl)-8-azoniatricyclo[4.3.0.02,5]non-3-ene-7,9-dione |
| SMILES | O=C1C2C3C=CC3C2C(=O)[N+]1([O-])S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H6F3NO5S/c10-9(11,12)19(17,18)13(16)7(14)5-3-1-2-4(3)6(5)8(13)15/h1-6H |
| InChIKey | KYBNIRIPSZWZNK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|