C14H11ClF6O3S2 — CID 87942966
6-chloro-2-cyclobutyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;trifluoromethanesulfonate (PubChem CID 87942966) has the molecular formula C14H11ClF6O3S2 and a molecular weight of 440.81 g/mol. Its IUPAC name is 6-chloro-2-cyclobutyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;trifluoromethanesulfonate.
| Compound Name | 6-chloro-2-cyclobutyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87942966 |
| Molecular Formula | C14H11ClF6O3S2 |
| Molecular Weight | 440.81 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 6-chloro-2-cyclobutyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;trifluoromethanesulfonate |
| SMILES | FC(F)(F)[s+]1c(C2CCC2)cc2ccc(Cl)cc21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H11ClF3S.CHF3O3S/c14-10-5-4-9-6-11(8-2-1-3-8)18(12(9)7-10)13(15,16)17;2-1(3,4)8(5,6)7/h4-8H,1-3H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | OZZFNIUAYHKAFD-UHFFFAOYSA-M |
| XLogP | 6.04 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|