C16H19F3O4S2 — CID 160664910
2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;hydrogen sulfate (PubChem CID 160664910) has the molecular formula C16H19F3O4S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;hydrogen sulfate.
| Compound Name | 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;hydrogen sulfate |
|---|---|
| PubChem CID | 160664910 |
| Molecular Formula | C16H19F3O4S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;hydrogen sulfate |
| SMILES | FC(F)(F)[s+]1c(C2CCCCCC2)cc2ccccc21.O=S(=O)([O-])O |
| InChI | InChI=1S/C16H18F3S.H2O4S/c17-16(18,19)20-14-10-6-5-9-13(14)11-15(20)12-7-3-1-2-4-8-12;1-5(2,3)4/h5-6,9-12H,1-4,7-8H2;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | RMDVPKDJDKHUAQ-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|