C13H12O3 — CID 124920369
(1R,2R,6R,7S,8R,11S)-9-methyl-4-oxatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione (PubChem CID 124920369) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (1R,2R,6R,7S,8R,11S)-9-methyl-4-oxatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione.
| Compound Name | (1R,2R,6R,7S,8R,11S)-9-methyl-4-oxatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
|---|---|
| PubChem CID | 124920369 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (1R,2R,6R,7S,8R,11S)-9-methyl-4-oxatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
| SMILES | CC1=C[C@@H]2[C@H]3C=C[C@@H]([C@H]12)[C@H]1C(=O)OC(=O)[C@H]31 |
| InChI | InChI=1S/C13H12O3/c1-5-4-8-6-2-3-7(9(5)8)11-10(6)12(14)16-13(11)15/h2-4,6-11H,1H3/t6-,7+,8-,9+,10-,11-/m1/s1 |
| InChIKey | SHNKPHYZJIVILY-UATFONFRSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|