C12H10FNO2 — CID 100896127
(1S,2R,6R,7R,8S,11R)-9-fluoro-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione (PubChem CID 100896127) has the molecular formula C12H10FNO2 and a molecular weight of 219.21 g/mol. Its IUPAC name is (1S,2R,6R,7R,8S,11R)-9-fluoro-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione.
| Compound Name | (1S,2R,6R,7R,8S,11R)-9-fluoro-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
|---|---|
| PubChem CID | 100896127 |
| Molecular Formula | C12H10FNO2 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (1S,2R,6R,7R,8S,11R)-9-fluoro-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
| SMILES | O=C1NC(=O)[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C=C(F)[C@H]43)[C@@H]12 |
| InChI | InChI=1S/C12H10FNO2/c13-7-3-6-4-1-2-5(8(6)7)10-9(4)11(15)14-12(10)16/h1-6,8-10H,(H,14,15,16)/t4-,5-,6-,8-,9+,10+/m0/s1 |
| InChIKey | ZZZYYJMMKJFFAF-HXROFGBISA-N |
| XLogP | 0.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|