C20H16N2O4S — CID 23265151
(1S,2R,3S,7R,8S,9R,10R,14R)-15-phenylsulfanyl-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 23265151) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is (1S,2R,3S,7R,8S,9R,10R,14R)-15-phenylsulfanyl-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | (1S,2R,3S,7R,8S,9R,10R,14R)-15-phenylsulfanyl-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 23265151 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (1S,2R,3S,7R,8S,9R,10R,14R)-15-phenylsulfanyl-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | O=C1NC(=O)[C@@H]2[C@@H]3C=C(Sc4ccccc4)[C@H]([C@H]12)[C@H]1[C@@H]2C(=O)NC(=O)[C@@H]2[C@@H]31 |
| InChI | InChI=1S/C20H16N2O4S/c23-17-11-8-6-9(27-7-4-2-1-3-5-7)12(15(11)19(25)21-17)13-10(8)14-16(13)20(26)22-18(14)24/h1-6,8,10-16H,(H,21,23,25)(H,22,24,26)/t8-,10+,11-,12+,13+,14-,15-,16+/m1/s1 |
| InChIKey | QNFZRMRAIXJCRU-DUJMSPGTSA-N |
| XLogP | 0.95 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|