C10H10O3S2 — CID 124630526
(3R)-1,1-dioxo-4-phenylsulfanyl-2,3-dihydrothiophen-3-ol (PubChem CID 124630526) has the molecular formula C10H10O3S2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (3R)-1,1-dioxo-4-phenylsulfanyl-2,3-dihydrothiophen-3-ol.
| Compound Name | (3R)-1,1-dioxo-4-phenylsulfanyl-2,3-dihydrothiophen-3-ol |
|---|---|
| PubChem CID | 124630526 |
| Molecular Formula | C10H10O3S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | (3R)-1,1-dioxo-4-phenylsulfanyl-2,3-dihydrothiophen-3-ol |
| SMILES | O=S1(=O)C=C(Sc2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C10H10O3S2/c11-9-6-15(12,13)7-10(9)14-8-4-2-1-3-5-8/h1-5,7,9,11H,6H2/t9-/m1/s1 |
| InChIKey | KNAPBKQJWBDGBO-SECBINFHSA-N |
| XLogP | 1.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |