C13H16OS — CID 131843099
(1R,5R)-2,5-dimethyl-3-phenylsulfanylcyclopent-2-en-1-ol (PubChem CID 131843099) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is (1R,5R)-2,5-dimethyl-3-phenylsulfanylcyclopent-2-en-1-ol.
| Compound Name | (1R,5R)-2,5-dimethyl-3-phenylsulfanylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 131843099 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (1R,5R)-2,5-dimethyl-3-phenylsulfanylcyclopent-2-en-1-ol |
| SMILES | CC1=C(Sc2ccccc2)C[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C13H16OS/c1-9-8-12(10(2)13(9)14)15-11-6-4-3-5-7-11/h3-7,9,13-14H,8H2,1-2H3/t9-,13-/m1/s1 |
| InChIKey | GTVQJTUZIVPOHA-NOZJJQNGSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |