C21H18N2O3 — CID 102321654
(1R,2R,6S,7R)-8-(hydroxy-phenyl-pyridin-2-ylmethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 102321654) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is (1R,2R,6S,7R)-8-(hydroxy-phenyl-pyridin-2-ylmethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-8-(hydroxy-phenyl-pyridin-2-ylmethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 102321654 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (1R,2R,6S,7R)-8-(hydroxy-phenyl-pyridin-2-ylmethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1NC(=O)[C@H]2[C@@H]1[C@H]1C[C@@H]2C=C1C(O)(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C21H18N2O3/c24-19-17-12-10-14(18(17)20(25)23-19)15(11-12)21(26,13-6-2-1-3-7-13)16-8-4-5-9-22-16/h1-9,11-12,14,17-18,26H,10H2,(H,23,24,25)/t12-,14+,17-,18+,21?/m1/s1 |
| InChIKey | HJKICPDOSDEUDV-KXSUGVDASA-N |
| XLogP | 1.78 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|