C33H25N3O3 — CID 124518798
(1R,2S,6S,7S,10E)-8-[(S)-hydroxy-phenyl-pyridin-2-ylmethyl]-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 124518798) has the molecular formula C33H25N3O3 and a molecular weight of 511.58 g/mol. Its IUPAC name is (1R,2S,6S,7S,10E)-8-[(S)-hydroxy-phenyl-pyridin-2-ylmethyl]-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7S,10E)-8-[(S)-hydroxy-phenyl-pyridin-2-ylmethyl]-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 124518798 |
| Molecular Formula | C33H25N3O3 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | (1R,2S,6S,7S,10E)-8-[(S)-hydroxy-phenyl-pyridin-2-ylmethyl]-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1NC(=O)[C@@H]2[C@@H]1[C@@H]1C([C@@](O)(c3ccccc3)c3ccccn3)=C[C@H]2/C1=C(/c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C33H25N3O3/c37-31-28-22-19-23(33(39,21-13-5-2-6-14-21)25-16-8-10-18-35-25)29(30(28)32(38)36-31)27(22)26(20-11-3-1-4-12-20)24-15-7-9-17-34-24/h1-19,22,28-30,39H,(H,36,37,38)/b27-26+/t22-,28-,29+,30+,33-/m0/s1 |
| InChIKey | DNTHHIVFNQZZRD-KBPQHYLRSA-N |
| XLogP | 4.29 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|