C8H5NOS3 — CID 102346114
5-phenylsulfanyl-1,2,4-dithiazol-3-one (PubChem CID 102346114) has the molecular formula C8H5NOS3 and a molecular weight of 227.34 g/mol. Its IUPAC name is 5-phenylsulfanyl-1,2,4-dithiazol-3-one.
| Compound Name | 5-phenylsulfanyl-1,2,4-dithiazol-3-one |
|---|---|
| PubChem CID | 102346114 |
| Molecular Formula | C8H5NOS3 |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 226.95 |
| IUPAC Name | 5-phenylsulfanyl-1,2,4-dithiazol-3-one |
| SMILES | O=c1nc(Sc2ccccc2)ss1 |
| InChI | InChI=1S/C8H5NOS3/c10-7-9-8(13-12-7)11-6-4-2-1-3-5-6/h1-5H |
| InChIKey | IEZOMXNLSLVZSH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |