C16H12N2S2 — CID 86197506
2,3-bis(phenylsulfanyl)pyrazine (PubChem CID 86197506) has the molecular formula C16H12N2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2,3-bis(phenylsulfanyl)pyrazine.
| Compound Name | 2,3-bis(phenylsulfanyl)pyrazine |
|---|---|
| PubChem CID | 86197506 |
| Molecular Formula | C16H12N2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2,3-bis(phenylsulfanyl)pyrazine |
| SMILES | c1ccc(Sc2nccnc2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C16H12N2S2/c1-3-7-13(8-4-1)19-15-16(18-12-11-17-15)20-14-9-5-2-6-10-14/h1-12H |
| InChIKey | LCFRUMMLJIDMLJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |