C18H15NO2S — CID 137395416
(5R)-7-phenyl-1-phenylsulfanyl-3-azabicyclo[3.2.0]heptane-2,4-dione (PubChem CID 137395416) has the molecular formula C18H15NO2S and a molecular weight of 309.39 g/mol. Its IUPAC name is (5R)-7-phenyl-1-phenylsulfanyl-3-azabicyclo[3.2.0]heptane-2,4-dione.
| Compound Name | (5R)-7-phenyl-1-phenylsulfanyl-3-azabicyclo[3.2.0]heptane-2,4-dione |
|---|---|
| PubChem CID | 137395416 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (5R)-7-phenyl-1-phenylsulfanyl-3-azabicyclo[3.2.0]heptane-2,4-dione |
| SMILES | O=C1NC(=O)C2(Sc3ccccc3)C(c3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C18H15NO2S/c20-16-15-11-14(12-7-3-1-4-8-12)18(15,17(21)19-16)22-13-9-5-2-6-10-13/h1-10,14-15H,11H2,(H,19,20,21)/t14?,15-,18?/m1/s1 |
| InChIKey | AKNCVWRZHIODSH-SWKXRBFHSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|