C18H19NO2S2 — CID 13145915
5-ethoxy-3,3-bis(phenylsulfanyl)pyrrolidin-2-one (PubChem CID 13145915) has the molecular formula C18H19NO2S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 5-ethoxy-3,3-bis(phenylsulfanyl)pyrrolidin-2-one.
| Compound Name | 5-ethoxy-3,3-bis(phenylsulfanyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 13145915 |
| Molecular Formula | C18H19NO2S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 5-ethoxy-3,3-bis(phenylsulfanyl)pyrrolidin-2-one |
| SMILES | CCOC1CC(Sc2ccccc2)(Sc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C18H19NO2S2/c1-2-21-16-13-18(17(20)19-16,22-14-9-5-3-6-10-14)23-15-11-7-4-8-12-15/h3-12,16H,2,13H2,1H3,(H,19,20) |
| InChIKey | ITNNXXXRBDXHPK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|