C16H21O3PS2 — CID 129043553
3-diethoxyphosphoryl-3-phenylsulfanyl-2-thiabicyclo[2.2.1]hept-5-ene (PubChem CID 129043553) has the molecular formula C16H21O3PS2 and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-3-phenylsulfanyl-2-thiabicyclo[2.2.1]hept-5-ene.
| Compound Name | 3-diethoxyphosphoryl-3-phenylsulfanyl-2-thiabicyclo[2.2.1]hept-5-ene |
|---|---|
| PubChem CID | 129043553 |
| Molecular Formula | C16H21O3PS2 |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 3-diethoxyphosphoryl-3-phenylsulfanyl-2-thiabicyclo[2.2.1]hept-5-ene |
| SMILES | CCOP(=O)(OCC)C1(Sc2ccccc2)SC2C=CC1C2 |
| InChI | InChI=1S/C16H21O3PS2/c1-3-18-20(17,19-4-2)16(13-10-11-15(12-13)22-16)21-14-8-6-5-7-9-14/h5-11,13,15H,3-4,12H2,1-2H3 |
| InChIKey | NVRWWNJELRQUKH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|