C26H23N5O2S2 — CID 101419395
(4aR,7aS,8R)-3-methyl-8-(3-methyl-2-phenylsulfanylimidazol-4-yl)-2-phenylsulfanyl-4,4a,7a,8-tetrahydropyrrolo[3,4-f]benzimidazole-5,7-dione (PubChem CID 101419395) has the molecular formula C26H23N5O2S2 and a molecular weight of 501.64 g/mol. Its IUPAC name is (4aR,7aS,8R)-3-methyl-8-(3-methyl-2-phenylsulfanylimidazol-4-yl)-2-phenylsulfanyl-4,4a,7a,8-tetrahydropyrrolo[3,4-f]benzimidazole-5,7-dione.
| Compound Name | (4aR,7aS,8R)-3-methyl-8-(3-methyl-2-phenylsulfanylimidazol-4-yl)-2-phenylsulfanyl-4,4a,7a,8-tetrahydropyrrolo[3,4-f]benzimidazole-5,7-dione |
|---|---|
| PubChem CID | 101419395 |
| Molecular Formula | C26H23N5O2S2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | (4aR,7aS,8R)-3-methyl-8-(3-methyl-2-phenylsulfanylimidazol-4-yl)-2-phenylsulfanyl-4,4a,7a,8-tetrahydropyrrolo[3,4-f]benzimidazole-5,7-dione |
| SMILES | Cn1c([C@@H]2c3nc(Sc4ccccc4)n(C)c3C[C@H]3C(=O)NC(=O)[C@@H]23)cnc1Sc1ccccc1 |
| InChI | InChI=1S/C26H23N5O2S2/c1-30-18-13-17-20(24(33)29-23(17)32)21(22(18)28-26(30)35-16-11-7-4-8-12-16)19-14-27-25(31(19)2)34-15-9-5-3-6-10-15/h3-12,14,17,20-21H,13H2,1-2H3,(H,29,32,33)/t17-,20-,21+/m1/s1 |
| InChIKey | ZBIOELPHQCLNPU-UIFIKXQLSA-N |
| XLogP | 4.03 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|