C6H10N2O — CID 163931922
2-amino-5-methyl-2,5-dihydro-1H-pyridin-6-one (PubChem CID 163931922) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is 2-amino-5-methyl-2,5-dihydro-1H-pyridin-6-one.
| Compound Name | 2-amino-5-methyl-2,5-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 163931922 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 2-amino-5-methyl-2,5-dihydro-1H-pyridin-6-one |
| SMILES | CC1C=CC(N)NC1=O |
| InChI | InChI=1S/C6H10N2O/c1-4-2-3-5(7)8-6(4)9/h2-5H,7H2,1H3,(H,8,9) |
| InChIKey | RJJYEXNSWWIWBC-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|