C5H8N2OS — CID 123506307
5-methyl-2-sulfanyl-2,5-dihydro-1H-pyrimidin-6-one (PubChem CID 123506307) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is 5-methyl-2-sulfanyl-2,5-dihydro-1H-pyrimidin-6-one.
| Compound Name | 5-methyl-2-sulfanyl-2,5-dihydro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 123506307 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 5-methyl-2-sulfanyl-2,5-dihydro-1H-pyrimidin-6-one |
| SMILES | CC1C=NC(S)NC1=O |
| InChI | InChI=1S/C5H8N2OS/c1-3-2-6-5(9)7-4(3)8/h2-3,5,9H,1H3,(H,7,8) |
| InChIKey | AKXLTWZYMYZJIB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|