C5H8N2O2S — CID 141156271
5-methyl-1-(sulfanylmethyl)imidazolidine-2,4-dione (PubChem CID 141156271) has the molecular formula C5H8N2O2S and a molecular weight of 160.20 g/mol. Its IUPAC name is 5-methyl-1-(sulfanylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-1-(sulfanylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 141156271 |
| Molecular Formula | C5H8N2O2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 5-methyl-1-(sulfanylmethyl)imidazolidine-2,4-dione |
| SMILES | CC1C(=O)NC(=O)N1CS |
| InChI | InChI=1S/C5H8N2O2S/c1-3-4(8)6-5(9)7(3)2-10/h3,10H,2H2,1H3,(H,6,8,9) |
| InChIKey | CLIGTGHFIZNFIE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|