C12H14N2O2S — CID 142664147
(5R)-1-(benzylsulfanylmethyl)-5-methylimidazolidine-2,4-dione (PubChem CID 142664147) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is (5R)-1-(benzylsulfanylmethyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-1-(benzylsulfanylmethyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 142664147 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (5R)-1-(benzylsulfanylmethyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@H]1C(=O)NC(=O)N1CSCc1ccccc1 |
| InChI | InChI=1S/C12H14N2O2S/c1-9-11(15)13-12(16)14(9)8-17-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,13,15,16)/t9-/m1/s1 |
| InChIKey | ZHXQWOLCVHZCBC-SECBINFHSA-N |
| XLogP | 1.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|