C5H7NO2S — CID 141241085
3-methyl-5-sulfanylpyrrolidine-2,4-dione (PubChem CID 141241085) has the molecular formula C5H7NO2S and a molecular weight of 145.18 g/mol. Its IUPAC name is 3-methyl-5-sulfanylpyrrolidine-2,4-dione.
| Compound Name | 3-methyl-5-sulfanylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 141241085 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 3-methyl-5-sulfanylpyrrolidine-2,4-dione |
| SMILES | CC1C(=O)NC(S)C1=O |
| InChI | InChI=1S/C5H7NO2S/c1-2-3(7)5(9)6-4(2)8/h2,5,9H,1H3,(H,6,8) |
| InChIKey | ZKOADQJSHOKSGD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|