About 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium
4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium (PubChem CID 158063163) has the molecular formula C6H10N2OY
and a molecular weight of 215.06 g/mol. Its IUPAC name is 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium.
Analyze 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium?
The IUPAC name of 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium (CID 158063163) is 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium.
What is the SMILES notation for 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium?
The canonical SMILES for 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium is CC1=CNC(=O)NC1C.[Y].
What is the InChIKey of 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium?
The InChIKey is VMWTWQIUHLAKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.Y/c1-4-3-7-6(9)8-5(4)2;/h3,5H,1-2H3,(H2,7,8,9);.
What are the key properties of 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium?
4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium has a molecular weight of 215.06 g/mol, XLogP of 0.59, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3,4-dihydro-1H-pyrimidin-2-one;yttrium is sourced from PubChem (CID 158063163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).