C4H7N3O — CID 175817725
4-amino-4-deuterio-1,3-dihydropyrimidin-2-one (PubChem CID 175817725) has the molecular formula C4H7N3O and a molecular weight of 114.13 g/mol. Its IUPAC name is 4-amino-4-deuterio-1,3-dihydropyrimidin-2-one.
| Compound Name | 4-amino-4-deuterio-1,3-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 175817725 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 114.13 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 4-amino-4-deuterio-1,3-dihydropyrimidin-2-one |
| SMILES | [2H]C1(N)C=CNC(=O)N1 |
| InChI | InChI=1S/C4H7N3O/c5-3-1-2-6-4(8)7-3/h1-3H,5H2,(H2,6,7,8)/i3D |
| InChIKey | VHCGYVGVWSLOHQ-WFVSFCRTSA-N |
| XLogP | -0.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.13 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |