About 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one
4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 3279834) has the molecular formula C4H6FN3O
and a molecular weight of 131.11 g/mol. Its IUPAC name is 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one.
Analyze 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one?
The IUPAC name of 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one (CID 3279834) is 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one.
What is the SMILES notation for 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one?
The canonical SMILES for 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one is NC1NC(=O)NC=C1F.
What is the InChIKey of 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one?
The InChIKey is SGJHJTLXTSZBRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6FN3O/c5-2-1-7-4(9)8-3(2)6/h1,3H,6H2,(H2,7,8,9).
What are the key properties of 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one?
4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one has a molecular weight of 131.11 g/mol, XLogP of -0.61, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-fluoro-3,4-dihydro-1H-pyrimidin-2-one is sourced from PubChem (CID 3279834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).