C4H5BrN2O2 — CID 90731688
5-bromo-2-hydroxy-2,5-dihydro-1H-pyrimidin-6-one (PubChem CID 90731688) has the molecular formula C4H5BrN2O2 and a molecular weight of 193.00 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-2,5-dihydro-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-hydroxy-2,5-dihydro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 90731688 |
| Molecular Formula | C4H5BrN2O2 |
| Molecular Weight | 193.00 g/mol |
| Exact Mass | 191.95 |
| IUPAC Name | 5-bromo-2-hydroxy-2,5-dihydro-1H-pyrimidin-6-one |
| SMILES | O=C1NC(O)N=CC1Br |
| InChI | InChI=1S/C4H5BrN2O2/c5-2-1-6-4(9)7-3(2)8/h1-2,4,9H,(H,7,8) |
| InChIKey | GNWOBSFHASUELR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.00 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|