C10H9NO4 — CID 124866121
(1R,4R,7R,8R)-3-oxo-2,11-dioxatricyclo[5.4.0.04,8]undeca-5,9-diene-10-carboxamide (PubChem CID 124866121) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is (1R,4R,7R,8R)-3-oxo-2,11-dioxatricyclo[5.4.0.04,8]undeca-5,9-diene-10-carboxamide.
| Compound Name | (1R,4R,7R,8R)-3-oxo-2,11-dioxatricyclo[5.4.0.04,8]undeca-5,9-diene-10-carboxamide |
|---|---|
| PubChem CID | 124866121 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (1R,4R,7R,8R)-3-oxo-2,11-dioxatricyclo[5.4.0.04,8]undeca-5,9-diene-10-carboxamide |
| SMILES | NC(=O)C1=C[C@@H]2[C@H]3C=C[C@H]2C(=O)O[C@H]3O1 |
| InChI | InChI=1S/C10H9NO4/c11-8(12)7-3-6-4-1-2-5(6)10(14-7)15-9(4)13/h1-6,10H,(H2,11,12)/t4-,5-,6+,10-/m1/s1 |
| InChIKey | NBVNAFAEYGKTPJ-XTWHOAMZSA-N |
| XLogP | -0.31 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|