C13H17N3O2 — CID 143968972
5-piperazin-1-yl-3a,7a-dihydro-1-benzofuran-2-carboxamide (PubChem CID 143968972) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-piperazin-1-yl-3a,7a-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 5-piperazin-1-yl-3a,7a-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 143968972 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-piperazin-1-yl-3a,7a-dihydro-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)C1=CC2C=C(N3CCNCC3)C=CC2O1 |
| InChI | InChI=1S/C13H17N3O2/c14-13(17)12-8-9-7-10(1-2-11(9)18-12)16-5-3-15-4-6-16/h1-2,7-9,11,15H,3-6H2,(H2,14,17) |
| InChIKey | PWPNCFSPEDWKAH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |